C17H24N2O6 — CID 157050422
2-[2,4-diamino-5-(2-hydroxyethoxy)phenoxy]ethanol;2-methylbenzene-1,3-diol (PubChem CID 157050422) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[2,4-diamino-5-(2-hydroxyethoxy)phenoxy]ethanol;2-methylbenzene-1,3-diol.
| Compound Name | 2-[2,4-diamino-5-(2-hydroxyethoxy)phenoxy]ethanol;2-methylbenzene-1,3-diol |
|---|---|
| PubChem CID | 157050422 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-[2,4-diamino-5-(2-hydroxyethoxy)phenoxy]ethanol;2-methylbenzene-1,3-diol |
| SMILES | Cc1c(O)cccc1O.Nc1cc(N)c(OCCO)cc1OCCO |
| InChI | InChI=1S/C10H16N2O4.C7H8O2/c11-7-5-8(12)10(16-4-2-14)6-9(7)15-3-1-13;1-5-6(8)3-2-4-7(5)9/h5-6,13-14H,1-4,11-12H2;2-4,8-9H,1H3 |
| InChIKey | AADDDQLQXTVVQJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|