C25H30N2O2 — CID 100979538
4-[6-[(4-phenylphenyl)methoxy]hexoxy]benzene-1,3-diamine (PubChem CID 100979538) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 4-[6-[(4-phenylphenyl)methoxy]hexoxy]benzene-1,3-diamine.
| Compound Name | 4-[6-[(4-phenylphenyl)methoxy]hexoxy]benzene-1,3-diamine |
|---|---|
| PubChem CID | 100979538 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 4-[6-[(4-phenylphenyl)methoxy]hexoxy]benzene-1,3-diamine |
| SMILES | Nc1ccc(OCCCCCCOCc2ccc(-c3ccccc3)cc2)c(N)c1 |
| InChI | InChI=1S/C25H30N2O2/c26-23-14-15-25(24(27)18-23)29-17-7-2-1-6-16-28-19-20-10-12-22(13-11-20)21-8-4-3-5-9-21/h3-5,8-15,18H,1-2,6-7,16-17,19,26-27H2 |
| InChIKey | BFPKPNSVSOLLLM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|