C9H8F2O4 — CID 169438379
2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid (PubChem CID 169438379) has the molecular formula C9H8F2O4 and a molecular weight of 224.19 g/mol. Its IUPAC name is 2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid.
| Compound Name | 2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid |
|---|---|
| PubChem CID | 169438379 |
| Molecular Formula | C9H8F2O4 |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid |
| SMILES | [2H]C([2H])([2H])Oc1cc(C(=O)O)c(F)c(OC([2H])([2H])[2H])c1F |
| InChI | InChI=1S/C9H8F2O4/c1-14-5-3-4(9(12)13)6(10)8(15-2)7(5)11/h3H,1-2H3,(H,12,13)/i1D3,2D3 |
| InChIKey | LLRUPRYHYIFLJS-WFGJKAKNSA-N |
| XLogP | 1.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |