2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid

C9H8F2O4 — CID 169438379

IUPAC2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid
SMILES[2H]C([2H])([2H])Oc1cc(C(=O)O)c(F)c(OC([2H])([2H])[2H])c1F
InChIInChI=1S/C9H8F2O4/c1-14-5-3-4(9(12)13)6(10)8(15-2)7(5)11/h3H,1-2H3,(H,12,13)/i1D3,2D3
InChIKeyLLRUPRYHYIFLJS-WFGJKAKNSA-N
MW224.19 g/mol
LogP1.68
Rot. Bonds5

About 2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid

2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid (PubChem CID 169438379) has the molecular formula C9H8F2O4 and a molecular weight of 224.19 g/mol. Its IUPAC name is 2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid.

Molecular Properties

Compound Name2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid
PubChem CID169438379
Molecular FormulaC9H8F2O4
Molecular Weight224.19 g/mol
Exact Mass224.08
IUPAC Name2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid
SMILES[2H]C([2H])([2H])Oc1cc(C(=O)O)c(F)c(OC([2H])([2H])[2H])c1F
InChIInChI=1S/C9H8F2O4/c1-14-5-3-4(9(12)13)6(10)8(15-2)7(5)11/h3H,1-2H3,(H,12,13)/i1D3,2D3
InChIKeyLLRUPRYHYIFLJS-WFGJKAKNSA-N
XLogP1.68
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.19
LogP ≤ 51.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid?
The IUPAC name of 2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid (CID 169438379) is 2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid.
What is the SMILES notation for 2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid?
The canonical SMILES for 2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid is [2H]C([2H])([2H])Oc1cc(C(=O)O)c(F)c(OC([2H])([2H])[2H])c1F.
What is the InChIKey of 2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid?
The InChIKey is LLRUPRYHYIFLJS-WFGJKAKNSA-N. The full InChI is InChI=1S/C9H8F2O4/c1-14-5-3-4(9(12)13)6(10)8(15-2)7(5)11/h3H,1-2H3,(H,12,13)/i1D3,2D3.
What are the key properties of 2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid?
2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid has a molecular weight of 224.19 g/mol, XLogP of 1.68, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-3,5-bis(trideuteriomethoxy)benzoic acid is sourced from PubChem (CID 169438379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).