C12H19NO3Si — CID 156632330
3-[tert-butyl(dimethyl)silyl]oxypyridine-2-carboxylic acid (PubChem CID 156632330) has the molecular formula C12H19NO3Si and a molecular weight of 253.37 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxypyridine-2-carboxylic acid.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxypyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 156632330 |
| Molecular Formula | C12H19NO3Si |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxypyridine-2-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cccnc1C(=O)O |
| InChI | InChI=1S/C12H19NO3Si/c1-12(2,3)17(4,5)16-9-7-6-8-13-10(9)11(14)15/h6-8H,1-5H3,(H,14,15) |
| InChIKey | BFOMEQANSOCTDI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|