C19H22N2O7 — CID 159457473
tert-butyl 4-(3-hydroxy-2-pyridinyl)-4-oxobutanoate;3-hydroxypyridine-2-carboxylic acid (PubChem CID 159457473) has the molecular formula C19H22N2O7 and a molecular weight of 390.39 g/mol. Its IUPAC name is tert-butyl 4-(3-hydroxy-2-pyridinyl)-4-oxobutanoate;3-hydroxypyridine-2-carboxylic acid.
| Compound Name | tert-butyl 4-(3-hydroxy-2-pyridinyl)-4-oxobutanoate;3-hydroxypyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 159457473 |
| Molecular Formula | C19H22N2O7 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | tert-butyl 4-(3-hydroxy-2-pyridinyl)-4-oxobutanoate;3-hydroxypyridine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)CCC(=O)c1ncccc1O.O=C(O)c1ncccc1O |
| InChI | InChI=1S/C13H17NO4.C6H5NO3/c1-13(2,3)18-11(17)7-6-10(16)12-9(15)5-4-8-14-12;8-4-2-1-3-7-5(4)6(9)10/h4-5,8,15H,6-7H2,1-3H3;1-3,8H,(H,9,10) |
| InChIKey | LUDYKRBKGQIFDG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 146.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |