C14H9F6NO — CID 175020161
4-[difluoro-(2-fluorophenyl)methoxy]-3-(trifluoromethyl)aniline (PubChem CID 175020161) has the molecular formula C14H9F6NO and a molecular weight of 321.22 g/mol. Its IUPAC name is 4-[difluoro-(2-fluorophenyl)methoxy]-3-(trifluoromethyl)aniline.
| Compound Name | 4-[difluoro-(2-fluorophenyl)methoxy]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 175020161 |
| Molecular Formula | C14H9F6NO |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 4-[difluoro-(2-fluorophenyl)methoxy]-3-(trifluoromethyl)aniline |
| SMILES | Nc1ccc(OC(F)(F)c2ccccc2F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H9F6NO/c15-11-4-2-1-3-9(11)14(19,20)22-12-6-5-8(21)7-10(12)13(16,17)18/h1-7H,21H2 |
| InChIKey | UHXNOYLHTOVNLU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|