C32H22F3N2O7P — CID 20750494
1-[2-diphenylphosphoryl-4-[4-nitro-2-(trifluoromethyl)phenoxy]phenoxy]-2-methyl-4-nitrobenzene (PubChem CID 20750494) has the molecular formula C32H22F3N2O7P and a molecular weight of 634.50 g/mol. Its IUPAC name is 1-[2-diphenylphosphoryl-4-[4-nitro-2-(trifluoromethyl)phenoxy]phenoxy]-2-methyl-4-nitrobenzene.
| Compound Name | 1-[2-diphenylphosphoryl-4-[4-nitro-2-(trifluoromethyl)phenoxy]phenoxy]-2-methyl-4-nitrobenzene |
|---|---|
| PubChem CID | 20750494 |
| Molecular Formula | C32H22F3N2O7P |
| Molecular Weight | 634.50 g/mol |
| Exact Mass | 634.11 |
| IUPAC Name | 1-[2-diphenylphosphoryl-4-[4-nitro-2-(trifluoromethyl)phenoxy]phenoxy]-2-methyl-4-nitrobenzene |
| SMILES | Cc1cc([N+](=O)[O-])ccc1Oc1ccc(Oc2ccc([N+](=O)[O-])cc2C(F)(F)F)cc1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H22F3N2O7P/c1-21-18-22(36(38)39)12-15-28(21)44-30-17-14-24(43-29-16-13-23(37(40)41)19-27(29)32(33,34)35)20-31(30)45(42,25-8-4-2-5-9-25)26-10-6-3-7-11-26/h2-20H,1H3 |
| InChIKey | HULBQGUCOPJLTA-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.50 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|