About 1-dichlorophosphoryl-2,4-dimethoxybenzene
1-dichlorophosphoryl-2,4-dimethoxybenzene (PubChem CID 20548444) has the molecular formula C8H9Cl2O3P
and a molecular weight of 255.04 g/mol. Its IUPAC name is 1-dichlorophosphoryl-2,4-dimethoxybenzene.
Molecular Properties
| Compound Name | 1-dichlorophosphoryl-2,4-dimethoxybenzene |
| PubChem CID | 20548444 |
| Molecular Formula | C8H9Cl2O3P |
| Molecular Weight | 255.04 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | 1-dichlorophosphoryl-2,4-dimethoxybenzene |
| SMILES | COc1ccc(P(=O)(Cl)Cl)c(OC)c1 |
| InChI | InChI=1S/C8H9Cl2O3P/c1-12-6-3-4-8(14(9,10)11)7(5-6)13-2/h3-5H,1-2H3 |
| InChIKey | QDKVGXHTMUANCH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.04 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-dichlorophosphoryl-2,4-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-dichlorophosphoryl-2,4-dimethoxybenzene?
The IUPAC name of 1-dichlorophosphoryl-2,4-dimethoxybenzene (CID 20548444) is 1-dichlorophosphoryl-2,4-dimethoxybenzene.
What is the SMILES notation for 1-dichlorophosphoryl-2,4-dimethoxybenzene?
The canonical SMILES for 1-dichlorophosphoryl-2,4-dimethoxybenzene is COc1ccc(P(=O)(Cl)Cl)c(OC)c1.
What is the InChIKey of 1-dichlorophosphoryl-2,4-dimethoxybenzene?
The InChIKey is QDKVGXHTMUANCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Cl2O3P/c1-12-6-3-4-8(14(9,10)11)7(5-6)13-2/h3-5H,1-2H3.
What are the key properties of 1-dichlorophosphoryl-2,4-dimethoxybenzene?
1-dichlorophosphoryl-2,4-dimethoxybenzene has a molecular weight of 255.04 g/mol, XLogP of 3.00, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-dichlorophosphoryl-2,4-dimethoxybenzene is sourced from PubChem (CID 20548444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).