C20H18Cl2NO5P — CID 2272806
N-bis(4-chlorophenoxy)phosphoryl-2,5-dimethoxyaniline (PubChem CID 2272806) has the molecular formula C20H18Cl2NO5P and a molecular weight of 454.25 g/mol. Its IUPAC name is N-bis(4-chlorophenoxy)phosphoryl-2,5-dimethoxyaniline.
| Compound Name | N-bis(4-chlorophenoxy)phosphoryl-2,5-dimethoxyaniline |
|---|---|
| PubChem CID | 2272806 |
| Molecular Formula | C20H18Cl2NO5P |
| Molecular Weight | 454.25 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | N-bis(4-chlorophenoxy)phosphoryl-2,5-dimethoxyaniline |
| SMILES | COc1ccc(OC)c(NP(=O)(Oc2ccc(Cl)cc2)Oc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H18Cl2NO5P/c1-25-18-11-12-20(26-2)19(13-18)23-29(24,27-16-7-3-14(21)4-8-16)28-17-9-5-15(22)6-10-17/h3-13H,1-2H3,(H,23,24) |
| InChIKey | VHGCZSZNZNKDBO-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.25 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|