C24H22Cl2NO3P — CID 2317744
N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-2,5-dimethoxyaniline (PubChem CID 2317744) has the molecular formula C24H22Cl2NO3P and a molecular weight of 474.32 g/mol. Its IUPAC name is N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-2,5-dimethoxyaniline.
| Compound Name | N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-2,5-dimethoxyaniline |
|---|---|
| PubChem CID | 2317744 |
| Molecular Formula | C24H22Cl2NO3P |
| Molecular Weight | 474.32 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-2,5-dimethoxyaniline |
| SMILES | COc1ccc(OC)c(NP(=O)(/C=C(\Cl)c2ccccc2)/C=C(\Cl)c2ccccc2)c1 |
| InChI | InChI=1S/C24H22Cl2NO3P/c1-29-20-13-14-24(30-2)23(15-20)27-31(28,16-21(25)18-9-5-3-6-10-18)17-22(26)19-11-7-4-8-12-19/h3-17H,1-2H3,(H,27,28)/b21-16-,22-17- |
| InChIKey | IXWIDNDWJUBGLL-QLBLWQCWSA-N |
| XLogP | 7.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.32 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|