3-(2,5-dimethoxyanilino)-2-phenylprop-2-enoic acid

C17H17NO4 — CID 70039083

IUPAC3-(2,5-dimethoxyanilino)-2-phenylprop-2-enoic acid
SMILESCOc1ccc(OC)c(NC=C(C(=O)O)c2ccccc2)c1
InChIInChI=1S/C17H17NO4/c1-21-13-8-9-16(22-2)15(10-13)18-11-14(17(19)20)12-6-4-3-5-7-12/h3-11,18H,1-2H3,(H,19,20)
InChIKeyWGVKDPAIVTUBLI-UHFFFAOYSA-N
MW299.33 g/mol
LogP3.24
Rot. Bonds6

About 3-(2,5-dimethoxyanilino)-2-phenylprop-2-enoic acid

3-(2,5-dimethoxyanilino)-2-phenylprop-2-enoic acid (PubChem CID 70039083) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 3-(2,5-dimethoxyanilino)-2-phenylprop-2-enoic acid.

Molecular Properties

Compound Name3-(2,5-dimethoxyanilino)-2-phenylprop-2-enoic acid
PubChem CID70039083
Molecular FormulaC17H17NO4
Molecular Weight299.33 g/mol
Exact Mass299.12
IUPAC Name3-(2,5-dimethoxyanilino)-2-phenylprop-2-enoic acid
SMILESCOc1ccc(OC)c(NC=C(C(=O)O)c2ccccc2)c1
InChIInChI=1S/C17H17NO4/c1-21-13-8-9-16(22-2)15(10-13)18-11-14(17(19)20)12-6-4-3-5-7-12/h3-11,18H,1-2H3,(H,19,20)
InChIKeyWGVKDPAIVTUBLI-UHFFFAOYSA-N
XLogP3.24
TPSA67.79 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500299.33
LogP ≤ 53.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-(2,5-dimethoxyanilino)-2-phenylprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,5-dimethoxyanilino)-2-phenylprop-2-enoic acid?
The IUPAC name of 3-(2,5-dimethoxyanilino)-2-phenylprop-2-enoic acid (CID 70039083) is 3-(2,5-dimethoxyanilino)-2-phenylprop-2-enoic acid.
What is the SMILES notation for 3-(2,5-dimethoxyanilino)-2-phenylprop-2-enoic acid?
The canonical SMILES for 3-(2,5-dimethoxyanilino)-2-phenylprop-2-enoic acid is COc1ccc(OC)c(NC=C(C(=O)O)c2ccccc2)c1.
What is the InChIKey of 3-(2,5-dimethoxyanilino)-2-phenylprop-2-enoic acid?
The InChIKey is WGVKDPAIVTUBLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO4/c1-21-13-8-9-16(22-2)15(10-13)18-11-14(17(19)20)12-6-4-3-5-7-12/h3-11,18H,1-2H3,(H,19,20).
What are the key properties of 3-(2,5-dimethoxyanilino)-2-phenylprop-2-enoic acid?
3-(2,5-dimethoxyanilino)-2-phenylprop-2-enoic acid has a molecular weight of 299.33 g/mol, XLogP of 3.24, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethoxyanilino)-2-phenylprop-2-enoic acid is sourced from PubChem (CID 70039083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).