3-(3,5-dimethylanilino)-2-(4-methoxyphenyl)prop-2-enoic acid

C18H19NO3 — CID 70038814

IUPAC3-(3,5-dimethylanilino)-2-(4-methoxyphenyl)prop-2-enoic acid
SMILESCOc1ccc(C(=CNc2cc(C)cc(C)c2)C(=O)O)cc1
InChIInChI=1S/C18H19NO3/c1-12-8-13(2)10-15(9-12)19-11-17(18(20)21)14-4-6-16(22-3)7-5-14/h4-11,19H,1-3H3,(H,20,21)
InChIKeyDQOGDJZZIPMRCO-UHFFFAOYSA-N
MW297.35 g/mol
LogP3.85
Rot. Bonds5

About 3-(3,5-dimethylanilino)-2-(4-methoxyphenyl)prop-2-enoic acid

3-(3,5-dimethylanilino)-2-(4-methoxyphenyl)prop-2-enoic acid (PubChem CID 70038814) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 3-(3,5-dimethylanilino)-2-(4-methoxyphenyl)prop-2-enoic acid.

Molecular Properties

Compound Name3-(3,5-dimethylanilino)-2-(4-methoxyphenyl)prop-2-enoic acid
PubChem CID70038814
Molecular FormulaC18H19NO3
Molecular Weight297.35 g/mol
Exact Mass297.14
IUPAC Name3-(3,5-dimethylanilino)-2-(4-methoxyphenyl)prop-2-enoic acid
SMILESCOc1ccc(C(=CNc2cc(C)cc(C)c2)C(=O)O)cc1
InChIInChI=1S/C18H19NO3/c1-12-8-13(2)10-15(9-12)19-11-17(18(20)21)14-4-6-16(22-3)7-5-14/h4-11,19H,1-3H3,(H,20,21)
InChIKeyDQOGDJZZIPMRCO-UHFFFAOYSA-N
XLogP3.85
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.35
LogP ≤ 53.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-(3,5-dimethylanilino)-2-(4-methoxyphenyl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3,5-dimethylanilino)-2-(4-methoxyphenyl)prop-2-enoic acid?
The IUPAC name of 3-(3,5-dimethylanilino)-2-(4-methoxyphenyl)prop-2-enoic acid (CID 70038814) is 3-(3,5-dimethylanilino)-2-(4-methoxyphenyl)prop-2-enoic acid.
What is the SMILES notation for 3-(3,5-dimethylanilino)-2-(4-methoxyphenyl)prop-2-enoic acid?
The canonical SMILES for 3-(3,5-dimethylanilino)-2-(4-methoxyphenyl)prop-2-enoic acid is COc1ccc(C(=CNc2cc(C)cc(C)c2)C(=O)O)cc1.
What is the InChIKey of 3-(3,5-dimethylanilino)-2-(4-methoxyphenyl)prop-2-enoic acid?
The InChIKey is DQOGDJZZIPMRCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3/c1-12-8-13(2)10-15(9-12)19-11-17(18(20)21)14-4-6-16(22-3)7-5-14/h4-11,19H,1-3H3,(H,20,21).
What are the key properties of 3-(3,5-dimethylanilino)-2-(4-methoxyphenyl)prop-2-enoic acid?
3-(3,5-dimethylanilino)-2-(4-methoxyphenyl)prop-2-enoic acid has a molecular weight of 297.35 g/mol, XLogP of 3.85, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethylanilino)-2-(4-methoxyphenyl)prop-2-enoic acid is sourced from PubChem (CID 70038814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).