About (2-diphenylphosphoryl-4,5-dimethylphenyl)phosphane
(2-diphenylphosphoryl-4,5-dimethylphenyl)phosphane (PubChem CID 175349711) has the molecular formula C20H20OP2
and a molecular weight of 338.33 g/mol. Its IUPAC name is (2-diphenylphosphoryl-4,5-dimethylphenyl)phosphane.
Molecular Properties
| Compound Name | (2-diphenylphosphoryl-4,5-dimethylphenyl)phosphane |
| PubChem CID | 175349711 |
| Molecular Formula | C20H20OP2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (2-diphenylphosphoryl-4,5-dimethylphenyl)phosphane |
| SMILES | Cc1cc(P)c(P(=O)(c2ccccc2)c2ccccc2)cc1C |
| InChI | InChI=1S/C20H20OP2/c1-15-13-19(22)20(14-16(15)2)23(21,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-14H,22H2,1-2H3 |
| InChIKey | ZNYCTYHHFHQSEC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-diphenylphosphoryl-4,5-dimethylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-diphenylphosphoryl-4,5-dimethylphenyl)phosphane?
The IUPAC name of (2-diphenylphosphoryl-4,5-dimethylphenyl)phosphane (CID 175349711) is (2-diphenylphosphoryl-4,5-dimethylphenyl)phosphane.
What is the SMILES notation for (2-diphenylphosphoryl-4,5-dimethylphenyl)phosphane?
The canonical SMILES for (2-diphenylphosphoryl-4,5-dimethylphenyl)phosphane is Cc1cc(P)c(P(=O)(c2ccccc2)c2ccccc2)cc1C.
What is the InChIKey of (2-diphenylphosphoryl-4,5-dimethylphenyl)phosphane?
The InChIKey is ZNYCTYHHFHQSEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20OP2/c1-15-13-19(22)20(14-16(15)2)23(21,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-14H,22H2,1-2H3.
What are the key properties of (2-diphenylphosphoryl-4,5-dimethylphenyl)phosphane?
(2-diphenylphosphoryl-4,5-dimethylphenyl)phosphane has a molecular weight of 338.33 g/mol, XLogP of 3.44, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-diphenylphosphoryl-4,5-dimethylphenyl)phosphane is sourced from PubChem (CID 175349711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).