C32H28NO3P — CID 121406472
3-diphenylphosphoryl-N,N-bis(4-methoxyphenyl)aniline (PubChem CID 121406472) has the molecular formula C32H28NO3P and a molecular weight of 505.55 g/mol. Its IUPAC name is 3-diphenylphosphoryl-N,N-bis(4-methoxyphenyl)aniline.
| Compound Name | 3-diphenylphosphoryl-N,N-bis(4-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 121406472 |
| Molecular Formula | C32H28NO3P |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 3-diphenylphosphoryl-N,N-bis(4-methoxyphenyl)aniline |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2cccc(P(=O)(c3ccccc3)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C32H28NO3P/c1-35-28-20-16-25(17-21-28)33(26-18-22-29(36-2)23-19-26)27-10-9-15-32(24-27)37(34,30-11-5-3-6-12-30)31-13-7-4-8-14-31/h3-24H,1-2H3 |
| InChIKey | XANVMLRUQWZRHV-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|