C30H22F2NOP — CID 121406452
3-diphenylphosphoryl-N,N-bis(4-fluorophenyl)aniline (PubChem CID 121406452) has the molecular formula C30H22F2NOP and a molecular weight of 481.48 g/mol. Its IUPAC name is 3-diphenylphosphoryl-N,N-bis(4-fluorophenyl)aniline.
| Compound Name | 3-diphenylphosphoryl-N,N-bis(4-fluorophenyl)aniline |
|---|---|
| PubChem CID | 121406452 |
| Molecular Formula | C30H22F2NOP |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 3-diphenylphosphoryl-N,N-bis(4-fluorophenyl)aniline |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1cccc(N(c2ccc(F)cc2)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C30H22F2NOP/c31-23-14-18-25(19-15-23)33(26-20-16-24(32)17-21-26)27-8-7-13-30(22-27)35(34,28-9-3-1-4-10-28)29-11-5-2-6-12-29/h1-22H |
| InChIKey | MJTVLALZNWQHGW-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|