C41H31N2OP — CID 102144285
4-[2-(4-diphenylphosphorylphenyl)-4-pyridinyl]-N,N-diphenylaniline (PubChem CID 102144285) has the molecular formula C41H31N2OP and a molecular weight of 598.69 g/mol. Its IUPAC name is 4-[2-(4-diphenylphosphorylphenyl)-4-pyridinyl]-N,N-diphenylaniline.
| Compound Name | 4-[2-(4-diphenylphosphorylphenyl)-4-pyridinyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 102144285 |
| Molecular Formula | C41H31N2OP |
| Molecular Weight | 598.69 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | 4-[2-(4-diphenylphosphorylphenyl)-4-pyridinyl]-N,N-diphenylaniline |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc(-c2cc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)ccn2)cc1 |
| InChI | InChI=1S/C41H31N2OP/c44-45(38-17-9-3-10-18-38,39-19-11-4-12-20-39)40-27-23-33(24-28-40)41-31-34(29-30-42-41)32-21-25-37(26-22-32)43(35-13-5-1-6-14-35)36-15-7-2-8-16-36/h1-31H |
| InChIKey | FZYABJZDZJYNLD-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.69 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|