C41H31NO2P2 — CID 137420028
4-[2,6-bis(diphenylphosphoryl)phenyl]-2-phenylpyridine (PubChem CID 137420028) has the molecular formula C41H31NO2P2 and a molecular weight of 631.65 g/mol. Its IUPAC name is 4-[2,6-bis(diphenylphosphoryl)phenyl]-2-phenylpyridine.
| Compound Name | 4-[2,6-bis(diphenylphosphoryl)phenyl]-2-phenylpyridine |
|---|---|
| PubChem CID | 137420028 |
| Molecular Formula | C41H31NO2P2 |
| Molecular Weight | 631.65 g/mol |
| Exact Mass | 631.18 |
| IUPAC Name | 4-[2,6-bis(diphenylphosphoryl)phenyl]-2-phenylpyridine |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1cccc(P(=O)(c2ccccc2)c2ccccc2)c1-c1ccnc(-c2ccccc2)c1 |
| InChI | InChI=1S/C41H31NO2P2/c43-45(34-19-8-2-9-20-34,35-21-10-3-11-22-35)39-27-16-28-40(41(39)33-29-30-42-38(31-33)32-17-6-1-7-18-32)46(44,36-23-12-4-13-24-36)37-25-14-5-15-26-37/h1-31H |
| InChIKey | CCSRKOAIHYPBQU-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.65 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|