C47H35NP2S2 — CID 137420118
[3-diphenylphosphinothioyl-2-(2,6-diphenyl-4-pyridinyl)phenyl]-diphenyl-sulfanylidene-λ5-phosphane (PubChem CID 137420118) has the molecular formula C47H35NP2S2 and a molecular weight of 739.89 g/mol. Its IUPAC name is [3-diphenylphosphinothioyl-2-(2,6-diphenyl-4-pyridinyl)phenyl]-diphenyl-sulfanylidene-λ5-phosphane.
| Compound Name | [3-diphenylphosphinothioyl-2-(2,6-diphenyl-4-pyridinyl)phenyl]-diphenyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 137420118 |
| Molecular Formula | C47H35NP2S2 |
| Molecular Weight | 739.89 g/mol |
| Exact Mass | 739.17 |
| IUPAC Name | [3-diphenylphosphinothioyl-2-(2,6-diphenyl-4-pyridinyl)phenyl]-diphenyl-sulfanylidene-λ5-phosphane |
| SMILES | S=P(c1ccccc1)(c1ccccc1)c1cccc(P(=S)(c2ccccc2)c2ccccc2)c1-c1cc(-c2ccccc2)nc(-c2ccccc2)c1 |
| InChI | InChI=1S/C47H35NP2S2/c51-49(39-24-11-3-12-25-39,40-26-13-4-14-27-40)45-32-19-33-46(50(52,41-28-15-5-16-29-41)42-30-17-6-18-31-42)47(45)38-34-43(36-20-7-1-8-21-36)48-44(35-38)37-22-9-2-10-23-37/h1-35H |
| InChIKey | RCUKUVSIOXWOEI-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.89 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|