C27H20BrF2O4P — CID 58839332
5-bis(4-methylphenyl)phosphoryl-4-bromo-2,2-difluoro-7-phenoxy-1,3-benzodioxole (PubChem CID 58839332) has the molecular formula C27H20BrF2O4P and a molecular weight of 557.33 g/mol. Its IUPAC name is 5-bis(4-methylphenyl)phosphoryl-4-bromo-2,2-difluoro-7-phenoxy-1,3-benzodioxole.
| Compound Name | 5-bis(4-methylphenyl)phosphoryl-4-bromo-2,2-difluoro-7-phenoxy-1,3-benzodioxole |
|---|---|
| PubChem CID | 58839332 |
| Molecular Formula | C27H20BrF2O4P |
| Molecular Weight | 557.33 g/mol |
| Exact Mass | 556.03 |
| IUPAC Name | 5-bis(4-methylphenyl)phosphoryl-4-bromo-2,2-difluoro-7-phenoxy-1,3-benzodioxole |
| SMILES | Cc1ccc(P(=O)(c2ccc(C)cc2)c2cc(Oc3ccccc3)c3c(c2Br)OC(F)(F)O3)cc1 |
| InChI | InChI=1S/C27H20BrF2O4P/c1-17-8-12-20(13-9-17)35(31,21-14-10-18(2)11-15-21)23-16-22(32-19-6-4-3-5-7-19)25-26(24(23)28)34-27(29,30)33-25/h3-16H,1-2H3 |
| InChIKey | QDWDMMRLVDXVKO-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.33 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|