C27H22IO4P — CID 58839346
5-diphenylphosphoryl-4-iodo-2,2-dimethyl-7-phenoxy-1,3-benzodioxole (PubChem CID 58839346) has the molecular formula C27H22IO4P and a molecular weight of 568.35 g/mol. Its IUPAC name is 5-diphenylphosphoryl-4-iodo-2,2-dimethyl-7-phenoxy-1,3-benzodioxole.
| Compound Name | 5-diphenylphosphoryl-4-iodo-2,2-dimethyl-7-phenoxy-1,3-benzodioxole |
|---|---|
| PubChem CID | 58839346 |
| Molecular Formula | C27H22IO4P |
| Molecular Weight | 568.35 g/mol |
| Exact Mass | 568.03 |
| IUPAC Name | 5-diphenylphosphoryl-4-iodo-2,2-dimethyl-7-phenoxy-1,3-benzodioxole |
| SMILES | CC1(C)Oc2c(Oc3ccccc3)cc(P(=O)(c3ccccc3)c3ccccc3)c(I)c2O1 |
| InChI | InChI=1S/C27H22IO4P/c1-27(2)31-25-22(30-19-12-6-3-7-13-19)18-23(24(28)26(25)32-27)33(29,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-18H,1-2H3 |
| InChIKey | BVXQMVTUTKWXCJ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.35 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|