C60H54NO6P3 — CID 10748478
2-(2-diphenylphosphorylphenoxy)-N,N-bis[2-(2-diphenylphosphorylphenoxy)ethyl]ethanamine (PubChem CID 10748478) has the molecular formula C60H54NO6P3 and a molecular weight of 978.02 g/mol. Its IUPAC name is 2-(2-diphenylphosphorylphenoxy)-N,N-bis[2-(2-diphenylphosphorylphenoxy)ethyl]ethanamine.
| Compound Name | 2-(2-diphenylphosphorylphenoxy)-N,N-bis[2-(2-diphenylphosphorylphenoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 10748478 |
| Molecular Formula | C60H54NO6P3 |
| Molecular Weight | 978.02 g/mol |
| Exact Mass | 977.32 |
| IUPAC Name | 2-(2-diphenylphosphorylphenoxy)-N,N-bis[2-(2-diphenylphosphorylphenoxy)ethyl]ethanamine |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccccc1OCCN(CCOc1ccccc1P(=O)(c1ccccc1)c1ccccc1)CCOc1ccccc1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C60H54NO6P3/c62-68(49-25-7-1-8-26-49,50-27-9-2-10-28-50)58-40-22-19-37-55(58)65-46-43-61(44-47-66-56-38-20-23-41-59(56)69(63,51-29-11-3-12-30-51)52-31-13-4-14-32-52)45-48-67-57-39-21-24-42-60(57)70(64,53-33-15-5-16-34-53)54-35-17-6-18-36-54/h1-42H,43-48H2 |
| InChIKey | BMXAKPFZPFLENA-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 978.02 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|