C30H32O8P2 — CID 3354156
[2-[2-[2-[2-[2-[hydroxy(phenyl)phosphoryl]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]-phenylphosphinic acid (PubChem CID 3354156) has the molecular formula C30H32O8P2 and a molecular weight of 582.53 g/mol. Its IUPAC name is [2-[2-[2-[2-[2-[hydroxy(phenyl)phosphoryl]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]-phenylphosphinic acid.
| Compound Name | [2-[2-[2-[2-[2-[hydroxy(phenyl)phosphoryl]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]-phenylphosphinic acid |
|---|---|
| PubChem CID | 3354156 |
| Molecular Formula | C30H32O8P2 |
| Molecular Weight | 582.53 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | [2-[2-[2-[2-[2-[hydroxy(phenyl)phosphoryl]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]-phenylphosphinic acid |
| SMILES | O=P(O)(c1ccccc1)c1ccccc1OCCOCCOCCOc1ccccc1P(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C30H32O8P2/c31-39(32,25-11-3-1-4-12-25)29-17-9-7-15-27(29)37-23-21-35-19-20-36-22-24-38-28-16-8-10-18-30(28)40(33,34)26-13-5-2-6-14-26/h1-18H,19-24H2,(H,31,32)(H,33,34) |
| InChIKey | WFPAUELIGQVCFS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|