C63H60O4P4 — CID 102519620
[2-[bis[[2-bis(4-methylphenyl)phosphanylphenoxy]methyl]phosphorylmethoxy]phenyl]-bis(4-methylphenyl)phosphane (PubChem CID 102519620) has the molecular formula C63H60O4P4 and a molecular weight of 1005.07 g/mol. Its IUPAC name is [2-[bis[[2-bis(4-methylphenyl)phosphanylphenoxy]methyl]phosphorylmethoxy]phenyl]-bis(4-methylphenyl)phosphane.
| Compound Name | [2-[bis[[2-bis(4-methylphenyl)phosphanylphenoxy]methyl]phosphorylmethoxy]phenyl]-bis(4-methylphenyl)phosphane |
|---|---|
| PubChem CID | 102519620 |
| Molecular Formula | C63H60O4P4 |
| Molecular Weight | 1005.07 g/mol |
| Exact Mass | 1004.34 |
| IUPAC Name | [2-[bis[[2-bis(4-methylphenyl)phosphanylphenoxy]methyl]phosphorylmethoxy]phenyl]-bis(4-methylphenyl)phosphane |
| SMILES | Cc1ccc(P(c2ccc(C)cc2)c2ccccc2OCP(=O)(COc2ccccc2P(c2ccc(C)cc2)c2ccc(C)cc2)COc2ccccc2P(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C63H60O4P4/c1-46-19-31-52(32-20-46)68(53-33-21-47(2)22-34-53)61-16-10-7-13-58(61)65-43-71(64,44-66-59-14-8-11-17-62(59)69(54-35-23-48(3)24-36-54)55-37-25-49(4)26-38-55)45-67-60-15-9-12-18-63(60)70(56-39-27-50(5)28-40-56)57-41-29-51(6)30-42-57/h7-42H,43-45H2,1-6H3 |
| InChIKey | LBHOOHNUBSWMOR-UHFFFAOYSA-N |
| XLogP | 12.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.07 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|