C24H22FNO2S — CID 41086955
N-(2-benzoyl-4-methylphenyl)-4-(4-fluorophenyl)sulfanylbutanamide (PubChem CID 41086955) has the molecular formula C24H22FNO2S and a molecular weight of 407.51 g/mol. Its IUPAC name is N-(2-benzoyl-4-methylphenyl)-4-(4-fluorophenyl)sulfanylbutanamide.
| Compound Name | N-(2-benzoyl-4-methylphenyl)-4-(4-fluorophenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 41086955 |
| Molecular Formula | C24H22FNO2S |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N-(2-benzoyl-4-methylphenyl)-4-(4-fluorophenyl)sulfanylbutanamide |
| SMILES | Cc1ccc(NC(=O)CCCSc2ccc(F)cc2)c(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H22FNO2S/c1-17-9-14-22(21(16-17)24(28)18-6-3-2-4-7-18)26-23(27)8-5-15-29-20-12-10-19(25)11-13-20/h2-4,6-7,9-14,16H,5,8,15H2,1H3,(H,26,27) |
| InChIKey | VQIUUPDXBSSDLJ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|