C16H12F3IN2O2 — CID 108933632
2-iodo-N-[[4-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]benzamide (PubChem CID 108933632) has the molecular formula C16H12F3IN2O2 and a molecular weight of 448.18 g/mol. Its IUPAC name is 2-iodo-N-[[4-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]benzamide.
| Compound Name | 2-iodo-N-[[4-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 108933632 |
| Molecular Formula | C16H12F3IN2O2 |
| Molecular Weight | 448.18 g/mol |
| Exact Mass | 447.99 |
| IUPAC Name | 2-iodo-N-[[4-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(NC(=O)C(F)(F)F)cc1)c1ccccc1I |
| InChI | InChI=1S/C16H12F3IN2O2/c17-16(18,19)15(24)22-11-7-5-10(6-8-11)9-21-14(23)12-3-1-2-4-13(12)20/h1-8H,9H2,(H,21,23)(H,22,24) |
| InChIKey | GUXQDYMHRWWHHI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.18 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|