C21H19F3N2O2 — CID 55493467
4-pyrrol-1-yl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]benzamide (PubChem CID 55493467) has the molecular formula C21H19F3N2O2 and a molecular weight of 388.39 g/mol. Its IUPAC name is 4-pyrrol-1-yl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]benzamide.
| Compound Name | 4-pyrrol-1-yl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55493467 |
| Molecular Formula | C21H19F3N2O2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 4-pyrrol-1-yl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(COCC(F)(F)F)cc1)c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C21H19F3N2O2/c22-21(23,24)15-28-14-17-5-3-16(4-6-17)13-25-20(27)18-7-9-19(10-8-18)26-11-1-2-12-26/h1-12H,13-15H2,(H,25,27) |
| InChIKey | IPECKZQVSYUYKY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |