C19H15F3N2O2 — CID 57329537
(4-pyrrol-1-ylphenyl) N-[[4-(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 57329537) has the molecular formula C19H15F3N2O2 and a molecular weight of 360.34 g/mol. Its IUPAC name is (4-pyrrol-1-ylphenyl) N-[[4-(trifluoromethyl)phenyl]methyl]carbamate.
| Compound Name | (4-pyrrol-1-ylphenyl) N-[[4-(trifluoromethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 57329537 |
| Molecular Formula | C19H15F3N2O2 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (4-pyrrol-1-ylphenyl) N-[[4-(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1)Oc1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C19H15F3N2O2/c20-19(21,22)15-5-3-14(4-6-15)13-23-18(25)26-17-9-7-16(8-10-17)24-11-1-2-12-24/h1-12H,13H2,(H,23,25) |
| InChIKey | GXHQQYJERYKZCB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |