C22H20F2N2O3S — CID 24509057
(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methyl]prop-2-enamide (PubChem CID 24509057) has the molecular formula C22H20F2N2O3S and a molecular weight of 430.48 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 24509057 |
| Molecular Formula | C22H20F2N2O3S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methyl]prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)NCc2ccc(-c3csc(C)n3)cc2)c1OC(F)F |
| InChI | InChI=1S/C22H20F2N2O3S/c1-14-26-18(13-30-14)16-8-6-15(7-9-16)12-25-20(27)11-10-17-4-3-5-19(28-2)21(17)29-22(23)24/h3-11,13,22H,12H2,1-2H3,(H,25,27)/b11-10+ |
| InChIKey | VXAZDMAWMAMCTF-ZHACJKMWSA-N |
| XLogP | 5.06 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|