C11H9F2N5O2 — CID 75533554
(E)-3-[2-(difluoromethoxy)phenyl]-N-(2H-tetrazol-5-yl)prop-2-enamide (PubChem CID 75533554) has the molecular formula C11H9F2N5O2 and a molecular weight of 281.22 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-N-(2H-tetrazol-5-yl)prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-(2H-tetrazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 75533554 |
| Molecular Formula | C11H9F2N5O2 |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-(2H-tetrazol-5-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1OC(F)F)Nc1nn[nH]n1 |
| InChI | InChI=1S/C11H9F2N5O2/c12-10(13)20-8-4-2-1-3-7(8)5-6-9(19)14-11-15-17-18-16-11/h1-6,10H,(H2,14,15,16,17,18,19)/b6-5+ |
| InChIKey | OMANBXGNSKWEFI-AATRIKPKSA-N |
| XLogP | 1.45 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|