C18H17F2N3O3 — CID 36824573
(E)-3-[2-(difluoromethoxy)phenyl]-N-[3-(methylcarbamoylamino)phenyl]prop-2-enamide (PubChem CID 36824573) has the molecular formula C18H17F2N3O3 and a molecular weight of 361.35 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-N-[3-(methylcarbamoylamino)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[3-(methylcarbamoylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 36824573 |
| Molecular Formula | C18H17F2N3O3 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[3-(methylcarbamoylamino)phenyl]prop-2-enamide |
| SMILES | CNC(=O)Nc1cccc(NC(=O)/C=C/c2ccccc2OC(F)F)c1 |
| InChI | InChI=1S/C18H17F2N3O3/c1-21-18(25)23-14-7-4-6-13(11-14)22-16(24)10-9-12-5-2-3-8-15(12)26-17(19)20/h2-11,17H,1H3,(H,22,24)(H2,21,23,25)/b10-9+ |
| InChIKey | FPNJYQWVRHJJBW-MDZDMXLPSA-N |
| XLogP | 3.69 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|