C22H20F2N4O2 — CID 16602936
(E)-3-[2-(difluoromethoxy)phenyl]-N-(3-pyrrolidin-1-ylquinoxalin-2-yl)prop-2-enamide (PubChem CID 16602936) has the molecular formula C22H20F2N4O2 and a molecular weight of 410.42 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-N-(3-pyrrolidin-1-ylquinoxalin-2-yl)prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-(3-pyrrolidin-1-ylquinoxalin-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 16602936 |
| Molecular Formula | C22H20F2N4O2 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-(3-pyrrolidin-1-ylquinoxalin-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1OC(F)F)Nc1nc2ccccc2nc1N1CCCC1 |
| InChI | InChI=1S/C22H20F2N4O2/c23-22(24)30-18-10-4-1-7-15(18)11-12-19(29)27-20-21(28-13-5-6-14-28)26-17-9-3-2-8-16(17)25-20/h1-4,7-12,22H,5-6,13-14H2,(H,25,27,29)/b12-11+ |
| InChIKey | UFAACDDQAUHWHV-VAWYXSNFSA-N |
| XLogP | 4.48 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|