C17H20N4O — CID 30709253
3-methyl-N-(3-pyrrolidin-1-ylquinoxalin-2-yl)but-2-enamide (PubChem CID 30709253) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-methyl-N-(3-pyrrolidin-1-ylquinoxalin-2-yl)but-2-enamide.
| Compound Name | 3-methyl-N-(3-pyrrolidin-1-ylquinoxalin-2-yl)but-2-enamide |
|---|---|
| PubChem CID | 30709253 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 3-methyl-N-(3-pyrrolidin-1-ylquinoxalin-2-yl)but-2-enamide |
| SMILES | CC(C)=CC(=O)Nc1nc2ccccc2nc1N1CCCC1 |
| InChI | InChI=1S/C17H20N4O/c1-12(2)11-15(22)20-16-17(21-9-5-6-10-21)19-14-8-4-3-7-13(14)18-16/h3-4,7-8,11H,5-6,9-10H2,1-2H3,(H,18,20,22) |
| InChIKey | FAEDCRVXRWGHJC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|