C24H26N4O3 — CID 16582380
4-(4-acetylphenoxy)-N-(3-pyrrolidin-1-ylquinoxalin-2-yl)butanamide (PubChem CID 16582380) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 4-(4-acetylphenoxy)-N-(3-pyrrolidin-1-ylquinoxalin-2-yl)butanamide.
| Compound Name | 4-(4-acetylphenoxy)-N-(3-pyrrolidin-1-ylquinoxalin-2-yl)butanamide |
|---|---|
| PubChem CID | 16582380 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 4-(4-acetylphenoxy)-N-(3-pyrrolidin-1-ylquinoxalin-2-yl)butanamide |
| SMILES | CC(=O)c1ccc(OCCCC(=O)Nc2nc3ccccc3nc2N2CCCC2)cc1 |
| InChI | InChI=1S/C24H26N4O3/c1-17(29)18-10-12-19(13-11-18)31-16-6-9-22(30)27-23-24(28-14-4-5-15-28)26-21-8-3-2-7-20(21)25-23/h2-3,7-8,10-13H,4-6,9,14-16H2,1H3,(H,25,27,30) |
| InChIKey | PWTLQMQSNAECHE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|