C23H26FN5O3S — CID 16602917
4-[(4-fluorophenyl)sulfonyl-methylamino]-N-(3-pyrrolidin-1-ylquinoxalin-2-yl)butanamide (PubChem CID 16602917) has the molecular formula C23H26FN5O3S and a molecular weight of 471.56 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)sulfonyl-methylamino]-N-(3-pyrrolidin-1-ylquinoxalin-2-yl)butanamide.
| Compound Name | 4-[(4-fluorophenyl)sulfonyl-methylamino]-N-(3-pyrrolidin-1-ylquinoxalin-2-yl)butanamide |
|---|---|
| PubChem CID | 16602917 |
| Molecular Formula | C23H26FN5O3S |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 4-[(4-fluorophenyl)sulfonyl-methylamino]-N-(3-pyrrolidin-1-ylquinoxalin-2-yl)butanamide |
| SMILES | CN(CCCC(=O)Nc1nc2ccccc2nc1N1CCCC1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H26FN5O3S/c1-28(33(31,32)18-12-10-17(24)11-13-18)14-6-9-21(30)27-22-23(29-15-4-5-16-29)26-20-8-3-2-7-19(20)25-22/h2-3,7-8,10-13H,4-6,9,14-16H2,1H3,(H,25,27,30) |
| InChIKey | FMLDXGUWPQWTQY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |