C20H25FN4O3S — CID 32948870
4-[(4-fluorophenyl)sulfonyl-methylamino]-N-(5-pyrrolidin-1-yl-2-pyridinyl)butanamide (PubChem CID 32948870) has the molecular formula C20H25FN4O3S and a molecular weight of 420.51 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)sulfonyl-methylamino]-N-(5-pyrrolidin-1-yl-2-pyridinyl)butanamide.
| Compound Name | 4-[(4-fluorophenyl)sulfonyl-methylamino]-N-(5-pyrrolidin-1-yl-2-pyridinyl)butanamide |
|---|---|
| PubChem CID | 32948870 |
| Molecular Formula | C20H25FN4O3S |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 4-[(4-fluorophenyl)sulfonyl-methylamino]-N-(5-pyrrolidin-1-yl-2-pyridinyl)butanamide |
| SMILES | CN(CCCC(=O)Nc1ccc(N2CCCC2)cn1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H25FN4O3S/c1-24(29(27,28)18-9-6-16(21)7-10-18)12-4-5-20(26)23-19-11-8-17(15-22-19)25-13-2-3-14-25/h6-11,15H,2-5,12-14H2,1H3,(H,22,23,26) |
| InChIKey | OCNHBVIMGHJEKB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |