C17H22FN5O2S — CID 113028878
1-[6-(dimethylsulfamoylamino)-3-pyridinyl]-4-(4-fluorophenyl)piperazine (PubChem CID 113028878) has the molecular formula C17H22FN5O2S and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-[6-(dimethylsulfamoylamino)-3-pyridinyl]-4-(4-fluorophenyl)piperazine.
| Compound Name | 1-[6-(dimethylsulfamoylamino)-3-pyridinyl]-4-(4-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 113028878 |
| Molecular Formula | C17H22FN5O2S |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-[6-(dimethylsulfamoylamino)-3-pyridinyl]-4-(4-fluorophenyl)piperazine |
| SMILES | CN(C)S(=O)(=O)Nc1ccc(N2CCN(c3ccc(F)cc3)CC2)cn1 |
| InChI | InChI=1S/C17H22FN5O2S/c1-21(2)26(24,25)20-17-8-7-16(13-19-17)23-11-9-22(10-12-23)15-5-3-14(18)4-6-15/h3-8,13H,9-12H2,1-2H3,(H,19,20) |
| InChIKey | ZQTKDWAAQFDTHH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |