C11H18N4O2S — CID 113024377
2-(dimethylsulfamoylamino)-5-pyrrolidin-1-ylpyridine (PubChem CID 113024377) has the molecular formula C11H18N4O2S and a molecular weight of 270.36 g/mol. Its IUPAC name is 2-(dimethylsulfamoylamino)-5-pyrrolidin-1-ylpyridine.
| Compound Name | 2-(dimethylsulfamoylamino)-5-pyrrolidin-1-ylpyridine |
|---|---|
| PubChem CID | 113024377 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-(dimethylsulfamoylamino)-5-pyrrolidin-1-ylpyridine |
| SMILES | CN(C)S(=O)(=O)Nc1ccc(N2CCCC2)cn1 |
| InChI | InChI=1S/C11H18N4O2S/c1-14(2)18(16,17)13-11-6-5-10(9-12-11)15-7-3-4-8-15/h5-6,9H,3-4,7-8H2,1-2H3,(H,12,13) |
| InChIKey | SIEJLBLFXHROBS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |