C21H23N5O3S — CID 46683851
4-(dimethylsulfamoyl)-N-(3-pyrrolidin-1-ylquinoxalin-2-yl)benzamide (PubChem CID 46683851) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-(3-pyrrolidin-1-ylquinoxalin-2-yl)benzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-(3-pyrrolidin-1-ylquinoxalin-2-yl)benzamide |
|---|---|
| PubChem CID | 46683851 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-(3-pyrrolidin-1-ylquinoxalin-2-yl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)Nc2nc3ccccc3nc2N2CCCC2)cc1 |
| InChI | InChI=1S/C21H23N5O3S/c1-25(2)30(28,29)16-11-9-15(10-12-16)21(27)24-19-20(26-13-5-6-14-26)23-18-8-4-3-7-17(18)22-19/h3-4,7-12H,5-6,13-14H2,1-2H3,(H,22,24,27) |
| InChIKey | GOJSDKCYTPPMPY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |