C23H28N2O3 — CID 26070713
4-(4-acetylphenoxy)-N-(2-methyl-4-pyrrolidin-1-ylphenyl)butanamide (PubChem CID 26070713) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 4-(4-acetylphenoxy)-N-(2-methyl-4-pyrrolidin-1-ylphenyl)butanamide.
| Compound Name | 4-(4-acetylphenoxy)-N-(2-methyl-4-pyrrolidin-1-ylphenyl)butanamide |
|---|---|
| PubChem CID | 26070713 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 4-(4-acetylphenoxy)-N-(2-methyl-4-pyrrolidin-1-ylphenyl)butanamide |
| SMILES | CC(=O)c1ccc(OCCCC(=O)Nc2ccc(N3CCCC3)cc2C)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-17-16-20(25-13-3-4-14-25)9-12-22(17)24-23(27)6-5-15-28-21-10-7-19(8-11-21)18(2)26/h7-12,16H,3-6,13-15H2,1-2H3,(H,24,27) |
| InChIKey | QCBSRORTAHBHNL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|