C21H23NO6 — CID 119231587
2-[4-[4-(3-acetylphenoxy)butanoylamino]-3-methylphenoxy]acetic acid (PubChem CID 119231587) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-[4-[4-(3-acetylphenoxy)butanoylamino]-3-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[4-(3-acetylphenoxy)butanoylamino]-3-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 119231587 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 2-[4-[4-(3-acetylphenoxy)butanoylamino]-3-methylphenoxy]acetic acid |
| SMILES | CC(=O)c1cccc(OCCCC(=O)Nc2ccc(OCC(=O)O)cc2C)c1 |
| InChI | InChI=1S/C21H23NO6/c1-14-11-18(28-13-21(25)26)8-9-19(14)22-20(24)7-4-10-27-17-6-3-5-16(12-17)15(2)23/h3,5-6,8-9,11-12H,4,7,10,13H2,1-2H3,(H,22,24)(H,25,26) |
| InChIKey | SVYGOKDDFDDPMR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|