C21H23NO6 — CID 120687330
2-[4-[[5-(4-methoxyphenyl)-5-oxopentanoyl]amino]-3-methylphenoxy]acetic acid (PubChem CID 120687330) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-[4-[[5-(4-methoxyphenyl)-5-oxopentanoyl]amino]-3-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[[5-(4-methoxyphenyl)-5-oxopentanoyl]amino]-3-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 120687330 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 2-[4-[[5-(4-methoxyphenyl)-5-oxopentanoyl]amino]-3-methylphenoxy]acetic acid |
| SMILES | COc1ccc(C(=O)CCCC(=O)Nc2ccc(OCC(=O)O)cc2C)cc1 |
| InChI | InChI=1S/C21H23NO6/c1-14-12-17(28-13-21(25)26)10-11-18(14)22-20(24)5-3-4-19(23)15-6-8-16(27-2)9-7-15/h6-12H,3-5,13H2,1-2H3,(H,22,24)(H,25,26) |
| InChIKey | YTPUHFWIAKBLJM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |