C18H26N2O5 — CID 119231553
2-[4-[[5-(diethylamino)-5-oxopentanoyl]amino]-3-methylphenoxy]acetic acid (PubChem CID 119231553) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-[4-[[5-(diethylamino)-5-oxopentanoyl]amino]-3-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[[5-(diethylamino)-5-oxopentanoyl]amino]-3-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 119231553 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-[4-[[5-(diethylamino)-5-oxopentanoyl]amino]-3-methylphenoxy]acetic acid |
| SMILES | CCN(CC)C(=O)CCCC(=O)Nc1ccc(OCC(=O)O)cc1C |
| InChI | InChI=1S/C18H26N2O5/c1-4-20(5-2)17(22)8-6-7-16(21)19-15-10-9-14(11-13(15)3)25-12-18(23)24/h9-11H,4-8,12H2,1-3H3,(H,19,21)(H,23,24) |
| InChIKey | CCNIEZYIWZQUMZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |