C15H12BrNO4 — CID 6215097
(E)-N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-3-(furan-2-yl)prop-2-enamide (PubChem CID 6215097) has the molecular formula C15H12BrNO4 and a molecular weight of 350.17 g/mol. Its IUPAC name is (E)-N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6215097 |
| Molecular Formula | C15H12BrNO4 |
| Molecular Weight | 350.17 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | (E)-N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)Nc1cc2c(cc1Br)OCCO2 |
| InChI | InChI=1S/C15H12BrNO4/c16-11-8-13-14(21-7-6-20-13)9-12(11)17-15(18)4-3-10-2-1-5-19-10/h1-5,8-9H,6-7H2,(H,17,18)/b4-3+ |
| InChIKey | KOGNIWPSGHGJBP-ONEGZZNKSA-N |
| XLogP | 3.47 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.17 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|