C13H8F3NO2 — CID 4799293
3-(furan-2-yl)-N-(2,3,4-trifluorophenyl)prop-2-enamide (PubChem CID 4799293) has the molecular formula C13H8F3NO2 and a molecular weight of 267.21 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-(2,3,4-trifluorophenyl)prop-2-enamide.
| Compound Name | 3-(furan-2-yl)-N-(2,3,4-trifluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4799293 |
| Molecular Formula | C13H8F3NO2 |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 3-(furan-2-yl)-N-(2,3,4-trifluorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccco1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H8F3NO2/c14-9-4-5-10(13(16)12(9)15)17-11(18)6-3-8-2-1-7-19-8/h1-7H,(H,17,18) |
| InChIKey | WNCHEMRLQRQYFN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|