C18H17F3N2O3 — CID 26730638
(E)-3-(furan-2-yl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylprop-2-enamide (PubChem CID 26730638) has the molecular formula C18H17F3N2O3 and a molecular weight of 366.34 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylprop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 26730638 |
| Molecular Formula | C18H17F3N2O3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylprop-2-enamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C18H17F3N2O3/c1-2-9-23(16(25)8-5-12-4-3-10-26-12)11-15(24)22-14-7-6-13(19)17(20)18(14)21/h3-8,10H,2,9,11H2,1H3,(H,22,24)/b8-5+ |
| InChIKey | MICXJPTZBWBJSC-VMPITWQZSA-N |
| XLogP | 3.59 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|