C22H22F3N3O3 — CID 46558352
N-methyl-4-[(E)-3-oxo-3-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylamino]prop-1-enyl]benzamide (PubChem CID 46558352) has the molecular formula C22H22F3N3O3 and a molecular weight of 433.43 g/mol. Its IUPAC name is N-methyl-4-[(E)-3-oxo-3-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylamino]prop-1-enyl]benzamide.
| Compound Name | N-methyl-4-[(E)-3-oxo-3-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylamino]prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 46558352 |
| Molecular Formula | C22H22F3N3O3 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N-methyl-4-[(E)-3-oxo-3-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-propylamino]prop-1-enyl]benzamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)/C=C/c1ccc(C(=O)NC)cc1 |
| InChI | InChI=1S/C22H22F3N3O3/c1-3-12-28(13-18(29)27-17-10-9-16(23)20(24)21(17)25)19(30)11-6-14-4-7-15(8-5-14)22(31)26-2/h4-11H,3,12-13H2,1-2H3,(H,26,31)(H,27,29)/b11-6+ |
| InChIKey | LHVHRNHCYMXUMV-IZZDOVSWSA-N |
| XLogP | 3.35 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|