C21H18F6N2O2 — CID 74268753
N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 74268753) has the molecular formula C21H18F6N2O2 and a molecular weight of 444.38 g/mol. Its IUPAC name is N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 74268753 |
| Molecular Formula | C21H18F6N2O2 |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)C=Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F6N2O2/c1-2-10-29(12-17(30)28-16-8-7-15(22)19(23)20(16)24)18(31)9-6-13-4-3-5-14(11-13)21(25,26)27/h3-9,11H,2,10,12H2,1H3,(H,28,30) |
| InChIKey | NTFVZQUTZBMVSR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|