C16H23ClF3N3O2 — CID 119682430
2-methyl-3-(methylamino)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylpropanamide;hydrochloride (PubChem CID 119682430) has the molecular formula C16H23ClF3N3O2 and a molecular weight of 381.83 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylpropanamide;hydrochloride.
| Compound Name | 2-methyl-3-(methylamino)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119682430 |
| Molecular Formula | C16H23ClF3N3O2 |
| Molecular Weight | 381.83 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-methyl-3-(methylamino)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylpropanamide;hydrochloride |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)C(C)CNC.Cl |
| InChI | InChI=1S/C16H22F3N3O2.ClH/c1-4-7-22(16(24)10(2)8-20-3)9-13(23)21-12-6-5-11(17)14(18)15(12)19;/h5-6,10,20H,4,7-9H2,1-3H3,(H,21,23);1H |
| InChIKey | FWLQYBMCSYLGAA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.83 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|