C23H26ClN7O3 — CID 55354398
2-[[2-[5-chloro-2-(1,2,4-triazol-1-yl)anilino]-2-oxoethyl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 55354398) has the molecular formula C23H26ClN7O3 and a molecular weight of 483.96 g/mol. Its IUPAC name is 2-[[2-[5-chloro-2-(1,2,4-triazol-1-yl)anilino]-2-oxoethyl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[[2-[5-chloro-2-(1,2,4-triazol-1-yl)anilino]-2-oxoethyl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 55354398 |
| Molecular Formula | C23H26ClN7O3 |
| Molecular Weight | 483.96 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 2-[[2-[5-chloro-2-(1,2,4-triazol-1-yl)anilino]-2-oxoethyl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(N2CCOCC2)cc1)CC(=O)Nc1cc(Cl)ccc1-n1cncn1 |
| InChI | InChI=1S/C23H26ClN7O3/c1-29(13-22(32)27-18-3-5-19(6-4-18)30-8-10-34-11-9-30)14-23(33)28-20-12-17(24)2-7-21(20)31-16-25-15-26-31/h2-7,12,15-16H,8-11,13-14H2,1H3,(H,27,32)(H,28,33) |
| InChIKey | GKJSATXTSPTJFQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.96 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|