C20H21N5O2 — CID 52683223
(E)-2-cyano-3-(2-morpholin-4-ylpyrimidin-5-yl)-N-(2-phenylethyl)prop-2-enamide (PubChem CID 52683223) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is (E)-2-cyano-3-(2-morpholin-4-ylpyrimidin-5-yl)-N-(2-phenylethyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(2-morpholin-4-ylpyrimidin-5-yl)-N-(2-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 52683223 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | (E)-2-cyano-3-(2-morpholin-4-ylpyrimidin-5-yl)-N-(2-phenylethyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1cnc(N2CCOCC2)nc1)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C20H21N5O2/c21-13-18(19(26)22-7-6-16-4-2-1-3-5-16)12-17-14-23-20(24-15-17)25-8-10-27-11-9-25/h1-5,12,14-15H,6-11H2,(H,22,26)/b18-12+ |
| InChIKey | KZCPRHHDIHIDHZ-LDADJPATSA-N |
| XLogP | 1.58 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|